C19H28N4O — CID 95157495
(2R)-1-[5-(benzimidazol-1-yl)pentyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 95157495) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-1-[5-(benzimidazol-1-yl)pentyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[5-(benzimidazol-1-yl)pentyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95157495 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (2R)-1-[5-(benzimidazol-1-yl)pentyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCN1CCCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C19H28N4O/c1-21(2)19(24)18-11-8-14-22(18)12-6-3-7-13-23-15-20-16-9-4-5-10-17(16)23/h4-5,9-10,15,18H,3,6-8,11-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | RYEJUFVTMSUJEZ-GOSISDBHSA-N |
| XLogP | 2.76 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|