C15H24N2O5 — CID 95158318
1-[(2R)-2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-(2-methoxyethyl)urea (PubChem CID 95158318) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(2R)-2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 95158318 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC[C@@H](O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H24N2O5/c1-20-8-7-16-15(19)17-9-13(18)11-22-10-12-3-5-14(21-2)6-4-12/h3-6,13,18H,7-11H2,1-2H3,(H2,16,17,19)/t13-/m1/s1 |
| InChIKey | FFJXOYOOMSGFAX-CYBMUJFWSA-N |
| XLogP | 0.52 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|