C20H24N2O3 — CID 95160412
N-[3-[(1R)-1-methoxyethyl]phenyl]-N'-[(1R)-1-(2-methylphenyl)ethyl]oxamide (PubChem CID 95160412) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[3-[(1R)-1-methoxyethyl]phenyl]-N'-[(1R)-1-(2-methylphenyl)ethyl]oxamide.
| Compound Name | N-[3-[(1R)-1-methoxyethyl]phenyl]-N'-[(1R)-1-(2-methylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 95160412 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[3-[(1R)-1-methoxyethyl]phenyl]-N'-[(1R)-1-(2-methylphenyl)ethyl]oxamide |
| SMILES | CO[C@H](C)c1cccc(NC(=O)C(=O)N[C@H](C)c2ccccc2C)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-8-5-6-11-18(13)14(2)21-19(23)20(24)22-17-10-7-9-16(12-17)15(3)25-4/h5-12,14-15H,1-4H3,(H,21,23)(H,22,24)/t14-,15-/m1/s1 |
| InChIKey | OPMXKDYXLWEJJK-HUUCEWRRSA-N |
| XLogP | 3.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|