C19H26N2O3 — CID 98765324
N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-[3-[(1R)-1-methoxyethyl]phenyl]oxamide (PubChem CID 98765324) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-[3-[(1R)-1-methoxyethyl]phenyl]oxamide.
| Compound Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-[3-[(1R)-1-methoxyethyl]phenyl]oxamide |
|---|---|
| PubChem CID | 98765324 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-[3-[(1R)-1-methoxyethyl]phenyl]oxamide |
| SMILES | CO[C@H](C)c1cccc(NC(=O)C(=O)NC[C@@H]2C[C@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-12(24-2)14-4-3-5-17(10-14)21-19(23)18(22)20-11-16-9-13-6-7-15(16)8-13/h3-5,10,12-13,15-16H,6-9,11H2,1-2H3,(H,20,22)(H,21,23)/t12-,13+,15+,16+/m1/s1 |
| InChIKey | JYZTVIGSTWZRQS-VRKREXBASA-N |
| XLogP | 2.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|