C20H34N6O3S — CID 95160968
(2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 95160968) has the molecular formula C20H34N6O3S and a molecular weight of 438.60 g/mol. Its IUPAC name is (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 95160968 |
| Molecular Formula | C20H34N6O3S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)N(C)[C@@H]1CCS(=O)(=O)C1)N1CCN(Cc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C20H34N6O3S/c1-16(20(27)23(2)17-7-13-30(28,29)15-17)25-11-9-24(10-12-25)14-19-22-21-18-6-4-3-5-8-26(18)19/h16-17H,3-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | XVAATRCNAGCEQB-IAGOWNOFSA-N |
| XLogP | 0.16 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |