C23H29F3N4O5S — CID 95167786
(5R,9R)-7,7,9-trimethyl-3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 95167786) has the molecular formula C23H29F3N4O5S and a molecular weight of 530.57 g/mol. Its IUPAC name is (5R,9R)-7,7,9-trimethyl-3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,9R)-7,7,9-trimethyl-3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 95167786 |
| Molecular Formula | C23H29F3N4O5S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (5R,9R)-7,7,9-trimethyl-3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)N1CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC1)C2=O |
| InChI | InChI=1S/C23H29F3N4O5S/c1-14-10-22(2,3)13-23(11-14)20(32)30(21(33)27-23)12-17(31)28-6-8-29(9-7-28)36(34,35)16-5-4-15(24)18(25)19(16)26/h4-5,14H,6-13H2,1-3H3,(H,27,33)/t14-,23-/m1/s1 |
| InChIKey | HCHNAPRWUHYVPI-QKFKETGDSA-N |
| XLogP | 2.07 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|