C19H22FN3O3 — CID 95179362
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]propanamide (PubChem CID 95179362) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]propanamide |
|---|---|
| PubChem CID | 95179362 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)N[C@@H]1C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H22FN3O3/c20-13-5-3-4-12(10-13)14-11-15(14)21-16(24)6-9-23-17(25)19(22-18(23)26)7-1-2-8-19/h3-5,10,14-15H,1-2,6-9,11H2,(H,21,24)(H,22,26)/t14-,15-/m1/s1 |
| InChIKey | ZJLKZDRJOMMULK-HUUCEWRRSA-N |
| XLogP | 2.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|