C20H30N4 — CID 95199331
N,N,2,2-tetramethyl-3-[(4S)-4-(4-methylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]propan-1-amine (PubChem CID 95199331) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-3-[(4S)-4-(4-methylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]propan-1-amine.
| Compound Name | N,N,2,2-tetramethyl-3-[(4S)-4-(4-methylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 95199331 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | N,N,2,2-tetramethyl-3-[(4S)-4-(4-methylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]propan-1-amine |
| SMILES | Cc1ccc([C@H]2c3nc[nH]c3CCN2CC(C)(C)CN(C)C)cc1 |
| InChI | InChI=1S/C20H30N4/c1-15-6-8-16(9-7-15)19-18-17(21-14-22-18)10-11-24(19)13-20(2,3)12-23(4)5/h6-9,14,19H,10-13H2,1-5H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | SMTNSLAAEMRSAV-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |