C19H22F2N4O — CID 95201626
[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(3S)-3-methylpiperidin-3-yl]methanone (PubChem CID 95201626) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(3S)-3-methylpiperidin-3-yl]methanone.
| Compound Name | [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(3S)-3-methylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95201626 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(3S)-3-methylpiperidin-3-yl]methanone |
| SMILES | C[C@]1(C(=O)N2CCc3[nH]nc(-c4ccc(F)c(F)c4)c3C2)CCCNC1 |
| InChI | InChI=1S/C19H22F2N4O/c1-19(6-2-7-22-11-19)18(26)25-8-5-16-13(10-25)17(24-23-16)12-3-4-14(20)15(21)9-12/h3-4,9,22H,2,5-8,10-11H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | GDWZNYNISHHOLL-IBGZPJMESA-N |
| XLogP | 2.63 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |