C18H22N4O3 — CID 95205233
1-[(9aS)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-2-(2,3-dihydroindol-1-yl)ethane-1,2-dione (PubChem CID 95205233) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(9aS)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-2-(2,3-dihydroindol-1-yl)ethane-1,2-dione.
| Compound Name | 1-[(9aS)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-2-(2,3-dihydroindol-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 95205233 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[(9aS)-8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-2-(2,3-dihydroindol-1-yl)ethane-1,2-dione |
| SMILES | CN1CCN2CCN(C(=O)C(=O)N3CCc4ccccc43)C[C@H]2C1=O |
| InChI | InChI=1S/C18H22N4O3/c1-19-8-9-20-10-11-21(12-15(20)16(19)23)17(24)18(25)22-7-6-13-4-2-3-5-14(13)22/h2-5,15H,6-12H2,1H3/t15-/m0/s1 |
| InChIKey | WCOMUJYDIIBFLV-HNNXBMFYSA-N |
| XLogP | -0.44 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|