C19H27N3O2 — CID 95208919
N-[[(3S)-1-(1H-indol-2-ylmethyl)pyrrolidin-3-yl]methyl]-2-methoxy-2-methylpropanamide (PubChem CID 95208919) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[[(3S)-1-(1H-indol-2-ylmethyl)pyrrolidin-3-yl]methyl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[[(3S)-1-(1H-indol-2-ylmethyl)pyrrolidin-3-yl]methyl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 95208919 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[[(3S)-1-(1H-indol-2-ylmethyl)pyrrolidin-3-yl]methyl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)NC[C@@H]1CCN(Cc2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,24-3)18(23)20-11-14-8-9-22(12-14)13-16-10-15-6-4-5-7-17(15)21-16/h4-7,10,14,21H,8-9,11-13H2,1-3H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | GFUCRLIBXDURLP-AWEZNQCLSA-N |
| XLogP | 2.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |