C21H23N3 — CID 95212642
(2S)-N-(1H-benzimidazol-2-ylmethyl)-N-(3-phenylprop-2-ynyl)butan-2-amine (PubChem CID 95212642) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is (2S)-N-(1H-benzimidazol-2-ylmethyl)-N-(3-phenylprop-2-ynyl)butan-2-amine.
| Compound Name | (2S)-N-(1H-benzimidazol-2-ylmethyl)-N-(3-phenylprop-2-ynyl)butan-2-amine |
|---|---|
| PubChem CID | 95212642 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (2S)-N-(1H-benzimidazol-2-ylmethyl)-N-(3-phenylprop-2-ynyl)butan-2-amine |
| SMILES | CC[C@H](C)N(CC#Cc1ccccc1)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H23N3/c1-3-17(2)24(15-9-12-18-10-5-4-6-11-18)16-21-22-19-13-7-8-14-20(19)23-21/h4-8,10-11,13-14,17H,3,15-16H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | VOAJXIZSFJAZSP-KRWDZBQOSA-N |
| XLogP | 4.22 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|