C19H20N4 — CID 95213518
3-[(2S)-1-benzylazetidin-2-yl]-4-(3-methylphenyl)-1,2,4-triazole (PubChem CID 95213518) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[(2S)-1-benzylazetidin-2-yl]-4-(3-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-[(2S)-1-benzylazetidin-2-yl]-4-(3-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 95213518 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-[(2S)-1-benzylazetidin-2-yl]-4-(3-methylphenyl)-1,2,4-triazole |
| SMILES | Cc1cccc(-n2cnnc2[C@@H]2CCN2Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N4/c1-15-6-5-9-17(12-15)23-14-20-21-19(23)18-10-11-22(18)13-16-7-3-2-4-8-16/h2-9,12,14,18H,10-11,13H2,1H3/t18-/m0/s1 |
| InChIKey | MGSWEXGAGVHNPD-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |