C21H31N5 — CID 95223955
(4S)-4-(1-methylpyrazol-4-yl)-5-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95223955) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is (4S)-4-(1-methylpyrazol-4-yl)-5-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4S)-4-(1-methylpyrazol-4-yl)-5-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95223955 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | (4S)-4-(1-methylpyrazol-4-yl)-5-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CC1=C(CCN2CCc3[nH]cnc3[C@@H]2c2cnn(C)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31N5/c1-15-6-5-9-21(2,3)17(15)7-10-26-11-8-18-19(23-14-22-18)20(26)16-12-24-25(4)13-16/h12-14,20H,5-11H2,1-4H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | IQXQDEYGKDGEJZ-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|