C20H31N3O2 — CID 95228253
[(3R)-3-(3-azaspiro[5.5]undecan-9-ylamino)piperidin-1-yl]-(furan-2-yl)methanone (PubChem CID 95228253) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is [(3R)-3-(3-azaspiro[5.5]undecan-9-ylamino)piperidin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [(3R)-3-(3-azaspiro[5.5]undecan-9-ylamino)piperidin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 95228253 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | [(3R)-3-(3-azaspiro[5.5]undecan-9-ylamino)piperidin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC[C@@H](NC2CCC3(CCNCC3)CC2)C1 |
| InChI | InChI=1S/C20H31N3O2/c24-19(18-4-2-14-25-18)23-13-1-3-17(15-23)22-16-5-7-20(8-6-16)9-11-21-12-10-20/h2,4,14,16-17,21-22H,1,3,5-13,15H2/t17-/m1/s1 |
| InChIKey | GAGINVIOQHZHHR-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |