C16H24F2N4O2 — CID 95239541
(2S)-N-[(2R)-butan-2-yl]-2-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoylamino]propanamide (PubChem CID 95239541) has the molecular formula C16H24F2N4O2 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoylamino]propanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 95239541 |
| Molecular Formula | C16H24F2N4O2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[[4-(dimethylamino)-3,5-difluorophenyl]carbamoylamino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](C)NC(=O)Nc1cc(F)c(N(C)C)c(F)c1 |
| InChI | InChI=1S/C16H24F2N4O2/c1-6-9(2)19-15(23)10(3)20-16(24)21-11-7-12(17)14(22(4)5)13(18)8-11/h7-10H,6H2,1-5H3,(H,19,23)(H2,20,21,24)/t9-,10+/m1/s1 |
| InChIKey | QIVFGRRWTZVOPH-ZJUUUORDSA-N |
| XLogP | 2.46 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|