C13H12N6O4S — CID 95242415
N-[(5S)-4-methyl-5-[(4-nitrophenyl)diazenyl]-6-oxo-2-sulfanylidene-5H-pyrimidin-1-yl]acetamide (PubChem CID 95242415) has the molecular formula C13H12N6O4S and a molecular weight of 348.34 g/mol. Its IUPAC name is N-[(5S)-4-methyl-5-[(4-nitrophenyl)diazenyl]-6-oxo-2-sulfanylidene-5H-pyrimidin-1-yl]acetamide.
| Compound Name | N-[(5S)-4-methyl-5-[(4-nitrophenyl)diazenyl]-6-oxo-2-sulfanylidene-5H-pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95242415 |
| Molecular Formula | C13H12N6O4S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-[(5S)-4-methyl-5-[(4-nitrophenyl)diazenyl]-6-oxo-2-sulfanylidene-5H-pyrimidin-1-yl]acetamide |
| SMILES | CC(=O)NN1C(=O)[C@@H](/N=N/c2ccc([N+](=O)[O-])cc2)C(C)=NC1=S |
| InChI | InChI=1S/C13H12N6O4S/c1-7-11(12(21)18(13(24)14-7)17-8(2)20)16-15-9-3-5-10(6-4-9)19(22)23/h3-6,11H,1-2H3,(H,17,20)/b16-15+/t11-/m0/s1 |
| InChIKey | XIEMDOMVTFHJLN-RJLNKPMYSA-N |
| XLogP | 1.69 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|