C32H23ClN6O6 — CID 98390397
4-chloro-N-(4-methylphenyl)-N-[3-[(4R)-4-[(4-nitrophenyl)diazenyl]-5-oxo-3-phenyl-4H-pyrazol-1-yl]-3-oxopropanoyl]benzamide (PubChem CID 98390397) has the molecular formula C32H23ClN6O6 and a molecular weight of 623.03 g/mol. Its IUPAC name is 4-chloro-N-(4-methylphenyl)-N-[3-[(4R)-4-[(4-nitrophenyl)diazenyl]-5-oxo-3-phenyl-4H-pyrazol-1-yl]-3-oxopropanoyl]benzamide.
| Compound Name | 4-chloro-N-(4-methylphenyl)-N-[3-[(4R)-4-[(4-nitrophenyl)diazenyl]-5-oxo-3-phenyl-4H-pyrazol-1-yl]-3-oxopropanoyl]benzamide |
|---|---|
| PubChem CID | 98390397 |
| Molecular Formula | C32H23ClN6O6 |
| Molecular Weight | 623.03 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 4-chloro-N-(4-methylphenyl)-N-[3-[(4R)-4-[(4-nitrophenyl)diazenyl]-5-oxo-3-phenyl-4H-pyrazol-1-yl]-3-oxopropanoyl]benzamide |
| SMILES | Cc1ccc(N(C(=O)CC(=O)N2N=C(c3ccccc3)[C@@H](/N=N/c3ccc([N+](=O)[O-])cc3)C2=O)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H23ClN6O6/c1-20-7-15-25(16-8-20)37(31(42)22-9-11-23(33)12-10-22)27(40)19-28(41)38-32(43)30(29(36-38)21-5-3-2-4-6-21)35-34-24-13-17-26(18-14-24)39(44)45/h2-18,30H,19H2,1H3/b35-34+/t30-/m1/s1 |
| InChIKey | LVROGXZBMYMMQI-BLQAQOLKSA-N |
| XLogP | 6.05 |
| TPSA | 154.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.03 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|