C21H17ClN6O6 — CID 98390998
N-acetyl-N-(4-chlorophenyl)-3-[(4R)-3-methyl-4-[(3-nitrophenyl)diazenyl]-5-oxo-4H-pyrazol-1-yl]-3-oxopropanamide (PubChem CID 98390998) has the molecular formula C21H17ClN6O6 and a molecular weight of 484.86 g/mol. Its IUPAC name is N-acetyl-N-(4-chlorophenyl)-3-[(4R)-3-methyl-4-[(3-nitrophenyl)diazenyl]-5-oxo-4H-pyrazol-1-yl]-3-oxopropanamide.
| Compound Name | N-acetyl-N-(4-chlorophenyl)-3-[(4R)-3-methyl-4-[(3-nitrophenyl)diazenyl]-5-oxo-4H-pyrazol-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 98390998 |
| Molecular Formula | C21H17ClN6O6 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-acetyl-N-(4-chlorophenyl)-3-[(4R)-3-methyl-4-[(3-nitrophenyl)diazenyl]-5-oxo-4H-pyrazol-1-yl]-3-oxopropanamide |
| SMILES | CC(=O)N(C(=O)CC(=O)N1N=C(C)[C@@H](/N=N/c2cccc([N+](=O)[O-])c2)C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN6O6/c1-12-20(24-23-15-4-3-5-17(10-15)28(33)34)21(32)27(25-12)19(31)11-18(30)26(13(2)29)16-8-6-14(22)7-9-16/h3-10,20H,11H2,1-2H3/b24-23+/t20-/m1/s1 |
| InChIKey | BWYKHKMSRWKBEB-BBJJLJPOSA-N |
| XLogP | 3.41 |
| TPSA | 154.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|