C17H17ClN4O — CID 95273869
(6-chloro-1H-indol-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone (PubChem CID 95273869) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is (6-chloro-1H-indol-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone.
| Compound Name | (6-chloro-1H-indol-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95273869 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (6-chloro-1H-indol-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1c[nH]c2cc(Cl)ccc12)N1CCC[C@@H](n2cccn2)C1 |
| InChI | InChI=1S/C17H17ClN4O/c18-12-4-5-14-15(10-19-16(14)9-12)17(23)21-7-1-3-13(11-21)22-8-2-6-20-22/h2,4-6,8-10,13,19H,1,3,7,11H2/t13-/m1/s1 |
| InChIKey | OWQOBHUWDHKTSD-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |