C14H27N3O5S — CID 95274465
tert-butyl (2R)-2-[(morpholin-4-ylsulfonylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 95274465) has the molecular formula C14H27N3O5S and a molecular weight of 349.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(morpholin-4-ylsulfonylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(morpholin-4-ylsulfonylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95274465 |
| Molecular Formula | C14H27N3O5S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | tert-butyl (2R)-2-[(morpholin-4-ylsulfonylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CNS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H27N3O5S/c1-14(2,3)22-13(18)17-6-4-5-12(17)11-15-23(19,20)16-7-9-21-10-8-16/h12,15H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | IUIPDIRXQRFSLB-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |