C12H18N2O2 — CID 95276418
(3S)-N-(3-hydroxy-2-pyridinyl)-3,4-dimethylpentanamide (PubChem CID 95276418) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (3S)-N-(3-hydroxy-2-pyridinyl)-3,4-dimethylpentanamide.
| Compound Name | (3S)-N-(3-hydroxy-2-pyridinyl)-3,4-dimethylpentanamide |
|---|---|
| PubChem CID | 95276418 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3S)-N-(3-hydroxy-2-pyridinyl)-3,4-dimethylpentanamide |
| SMILES | CC(C)[C@@H](C)CC(=O)Nc1ncccc1O |
| InChI | InChI=1S/C12H18N2O2/c1-8(2)9(3)7-11(16)14-12-10(15)5-4-6-13-12/h4-6,8-9,15H,7H2,1-3H3,(H,13,14,16)/t9-/m0/s1 |
| InChIKey | KDGRIDAMZGUNIO-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |