C12H19N3O2 — CID 14006930
3-(3-hydroxy-2-pyridinyl)-1,1-dipropylurea (PubChem CID 14006930) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(3-hydroxy-2-pyridinyl)-1,1-dipropylurea.
| Compound Name | 3-(3-hydroxy-2-pyridinyl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 14006930 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(3-hydroxy-2-pyridinyl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ncccc1O |
| InChI | InChI=1S/C12H19N3O2/c1-3-8-15(9-4-2)12(17)14-11-10(16)6-5-7-13-11/h5-7,16H,3-4,8-9H2,1-2H3,(H,13,14,17) |
| InChIKey | LOBRHMFKVHUIGT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |