About 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole
2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole (PubChem CID 95277594) has the molecular formula C15H16N4O2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole |
| PubChem CID | 95277594 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(N3CCO[C@@H](Cn4cccn4)C3)nc2c1 |
| InChI | InChI=1S/C15H16N4O2/c1-2-5-14-13(4-1)17-15(21-14)18-8-9-20-12(10-18)11-19-7-3-6-16-19/h1-7,12H,8-11H2/t12-/m1/s1 |
| InChIKey | IDCVERMKWAIVBP-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole?
The IUPAC name of 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole (CID 95277594) is 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole?
The canonical SMILES for 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole is c1ccc2oc(N3CCO[C@@H](Cn4cccn4)C3)nc2c1.
What is the InChIKey of 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole?
The InChIKey is IDCVERMKWAIVBP-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H16N4O2/c1-2-5-14-13(4-1)17-15(21-14)18-8-9-20-12(10-18)11-19-7-3-6-16-19/h1-7,12H,8-11H2/t12-/m1/s1.
What are the key properties of 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole?
2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole has a molecular weight of 284.32 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]-1,3-benzoxazole is sourced from PubChem (CID 95277594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).