C17H13ClF2N2O5 — CID 95278682
methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-2-(2,5-difluorophenyl)propanoate (PubChem CID 95278682) has the molecular formula C17H13ClF2N2O5 and a molecular weight of 398.75 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-2-(2,5-difluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-2-(2,5-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 95278682 |
| Molecular Formula | C17H13ClF2N2O5 |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | methyl (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-2-(2,5-difluorophenyl)propanoate |
| SMILES | COC(=O)[C@@](C)(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H13ClF2N2O5/c1-17(16(24)27-2,12-7-9(19)3-6-14(12)20)21-15(23)11-5-4-10(22(25)26)8-13(11)18/h3-8H,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | LGDVBRRADIJBKX-KRWDZBQOSA-N |
| XLogP | 3.34 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|