C17H22N4O2 — CID 95279930
(2R)-N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)oxolane-2-carboxamide (PubChem CID 95279930) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R)-N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)oxolane-2-carboxamide.
| Compound Name | (2R)-N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 95279930 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R)-N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)oxolane-2-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@H]2CCCO2)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)13-11-15(19-16(22)12-7-6-10-23-12)21(20-13)14-8-4-5-9-18-14/h4-5,8-9,11-12H,6-7,10H2,1-3H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | ORELIJGYGIOJRA-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |