C21H30N6O2 — CID 97257711
N'-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-N-[(2S)-2-cyclopropyl-2-(dimethylamino)ethyl]oxamide (PubChem CID 97257711) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N'-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-N-[(2S)-2-cyclopropyl-2-(dimethylamino)ethyl]oxamide.
| Compound Name | N'-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-N-[(2S)-2-cyclopropyl-2-(dimethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 97257711 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N'-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-N-[(2S)-2-cyclopropyl-2-(dimethylamino)ethyl]oxamide |
| SMILES | CN(C)[C@H](CNC(=O)C(=O)Nc1cc(C(C)(C)C)nn1-c1ccccn1)C1CC1 |
| InChI | InChI=1S/C21H30N6O2/c1-21(2,3)16-12-18(27(25-16)17-8-6-7-11-22-17)24-20(29)19(28)23-13-15(26(4)5)14-9-10-14/h6-8,11-12,14-15H,9-10,13H2,1-5H3,(H,23,28)(H,24,29)/t15-/m1/s1 |
| InChIKey | RDLHOWCMFJPAOL-OAHLLOKOSA-N |
| XLogP | 1.96 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|