C20H17N3O3 — CID 95286366
[(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone (PubChem CID 95286366) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is [(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 95286366 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(2S)-2-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2n1)N1CCC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17N3O3/c24-20(16-11-21-14-4-1-2-5-15(14)22-16)23-9-3-6-17(23)13-7-8-18-19(10-13)26-12-25-18/h1-2,4-5,7-8,10-11,17H,3,6,9,12H2/t17-/m0/s1 |
| InChIKey | WRPYYPHXPJGZPR-KRWDZBQOSA-N |
| XLogP | 3.34 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |