C18H26N4O — CID 95292862
(2R)-4-[(3-methoxyphenyl)methyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine (PubChem CID 95292862) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R)-4-[(3-methoxyphenyl)methyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine.
| Compound Name | (2R)-4-[(3-methoxyphenyl)methyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 95292862 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2R)-4-[(3-methoxyphenyl)methyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine |
| SMILES | COc1cccc(CN2CCN(Cc3nccn3C)[C@H](C)C2)c1 |
| InChI | InChI=1S/C18H26N4O/c1-15-12-21(13-16-5-4-6-17(11-16)23-3)9-10-22(15)14-18-19-7-8-20(18)2/h4-8,11,15H,9-10,12-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | ZANPCGHWJDMKJR-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |