C19H28N4O — CID 95305075
(2R)-4-[2-(4-methoxyphenyl)ethyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine (PubChem CID 95305075) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-4-[2-(4-methoxyphenyl)ethyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine.
| Compound Name | (2R)-4-[2-(4-methoxyphenyl)ethyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 95305075 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (2R)-4-[2-(4-methoxyphenyl)ethyl]-2-methyl-1-[(1-methylimidazol-2-yl)methyl]piperazine |
| SMILES | COc1ccc(CCN2CCN(Cc3nccn3C)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C19H28N4O/c1-16-14-22(10-8-17-4-6-18(24-3)7-5-17)12-13-23(16)15-19-20-9-11-21(19)2/h4-7,9,11,16H,8,10,12-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | SWGYTWVBCCPFJS-MRXNPFEDSA-N |
| XLogP | 2.18 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |