C16H24N6 — CID 56802794
2-[[3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]methyl]pentanedinitrile (PubChem CID 56802794) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[[3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]methyl]pentanedinitrile.
| Compound Name | 2-[[3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 56802794 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-[[3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]methyl]pentanedinitrile |
| SMILES | CC1CN(CC(C#N)CCC#N)CCN1Cc1nccn1C |
| InChI | InChI=1S/C16H24N6/c1-14-11-21(12-15(10-18)4-3-5-17)8-9-22(14)13-16-19-6-7-20(16)2/h6-7,14-15H,3-4,8-9,11-13H2,1-2H3 |
| InChIKey | JDRBUEPHCPTOSP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |