C17H16ClNO3S — CID 95295464
N-[(1S,2S)-2-(2-chlorophenyl)cyclopropyl]-4-methylsulfonylbenzamide (PubChem CID 95295464) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is N-[(1S,2S)-2-(2-chlorophenyl)cyclopropyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(1S,2S)-2-(2-chlorophenyl)cyclopropyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 95295464 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[(1S,2S)-2-(2-chlorophenyl)cyclopropyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N[C@H]2C[C@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-23(21,22)12-8-6-11(7-9-12)17(20)19-16-10-14(16)13-4-2-3-5-15(13)18/h2-9,14,16H,10H2,1H3,(H,19,20)/t14-,16-/m0/s1 |
| InChIKey | NDHASXKKCNHTPN-HOCLYGCPSA-N |
| XLogP | 3.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |