C16H19NO5S — CID 95319371
methyl 5-[methyl-[(2S)-2-phenylpropyl]sulfamoyl]furan-2-carboxylate (PubChem CID 95319371) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 5-[methyl-[(2S)-2-phenylpropyl]sulfamoyl]furan-2-carboxylate.
| Compound Name | methyl 5-[methyl-[(2S)-2-phenylpropyl]sulfamoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 95319371 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methyl 5-[methyl-[(2S)-2-phenylpropyl]sulfamoyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(C)C[C@@H](C)c2ccccc2)o1 |
| InChI | InChI=1S/C16H19NO5S/c1-12(13-7-5-4-6-8-13)11-17(2)23(19,20)15-10-9-14(22-15)16(18)21-3/h4-10,12H,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | HKUXTNGUJQRYAB-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |