C17H24N4O2S — CID 95326111
(3S)-1-(4-tert-butylphenyl)sulfonyl-3-(1,2,4-triazol-1-yl)piperidine (PubChem CID 95326111) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (3S)-1-(4-tert-butylphenyl)sulfonyl-3-(1,2,4-triazol-1-yl)piperidine.
| Compound Name | (3S)-1-(4-tert-butylphenyl)sulfonyl-3-(1,2,4-triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 95326111 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3S)-1-(4-tert-butylphenyl)sulfonyl-3-(1,2,4-triazol-1-yl)piperidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC[C@H](n3cncn3)C2)cc1 |
| InChI | InChI=1S/C17H24N4O2S/c1-17(2,3)14-6-8-16(9-7-14)24(22,23)20-10-4-5-15(11-20)21-13-18-12-19-21/h6-9,12-13,15H,4-5,10-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | CJHSWMRRFKXQMN-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |