C20H29N3O2 — CID 95335504
trans-(1S,2S)-2-methyl-N-[3-oxo-3-[(4-piperidin-1-ylphenyl)methylamino]propyl]cyclopropane-1-carboxamide (PubChem CID 95335504) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is trans-(1S,2S)-2-methyl-N-[3-oxo-3-[(4-piperidin-1-ylphenyl)methylamino]propyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-methyl-N-[3-oxo-3-[(4-piperidin-1-ylphenyl)methylamino]propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95335504 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | trans-(1S,2S)-2-methyl-N-[3-oxo-3-[(4-piperidin-1-ylphenyl)methylamino]propyl]cyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@@H]1C(=O)NCCC(=O)NCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-15-13-18(15)20(25)21-10-9-19(24)22-14-16-5-7-17(8-6-16)23-11-3-2-4-12-23/h5-8,15,18H,2-4,9-14H2,1H3,(H,21,25)(H,22,24)/t15-,18-/m0/s1 |
| InChIKey | MXCSXCDUIARADW-YJBOKZPZSA-N |
| XLogP | 2.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|