C8H15NO3S — CID 95335768
(5R,9S)-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine (PubChem CID 95335768) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is (5R,9S)-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine.
| Compound Name | (5R,9S)-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 95335768 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (5R,9S)-2,2-dioxo-6-oxa-2λ6-thiaspiro[4.5]decan-9-amine |
| SMILES | N[C@H]1CCO[C@@]2(CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C8H15NO3S/c9-7-1-3-12-8(5-7)2-4-13(10,11)6-8/h7H,1-6,9H2/t7-,8-/m0/s1 |
| InChIKey | MMTJOUXZLPXXSE-YUMQZZPRSA-N |
| XLogP | -0.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |