C15H23N3O2S — CID 95337196
(E)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 95337196) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is (E)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 95337196 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (E)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CN(C)CCN(C[C@H]1CCCO1)C(=O)/C=C/c1cscn1 |
| InChI | InChI=1S/C15H23N3O2S/c1-17(2)7-8-18(10-14-4-3-9-20-14)15(19)6-5-13-11-21-12-16-13/h5-6,11-12,14H,3-4,7-10H2,1-2H3/b6-5+/t14-/m1/s1 |
| InChIKey | IDMTYCXEFLKOAF-VBROQKIQSA-N |
| XLogP | 1.73 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|