C19H27FN4O — CID 95338013
(1R)-2-[(2R)-2-ethyl-4-(2-pyrazol-1-ylethyl)piperazin-1-yl]-1-(2-fluorophenyl)ethanol (PubChem CID 95338013) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is (1R)-2-[(2R)-2-ethyl-4-(2-pyrazol-1-ylethyl)piperazin-1-yl]-1-(2-fluorophenyl)ethanol.
| Compound Name | (1R)-2-[(2R)-2-ethyl-4-(2-pyrazol-1-ylethyl)piperazin-1-yl]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 95338013 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (1R)-2-[(2R)-2-ethyl-4-(2-pyrazol-1-ylethyl)piperazin-1-yl]-1-(2-fluorophenyl)ethanol |
| SMILES | CC[C@@H]1CN(CCn2cccn2)CCN1C[C@H](O)c1ccccc1F |
| InChI | InChI=1S/C19H27FN4O/c1-2-16-14-22(11-13-24-9-5-8-21-24)10-12-23(16)15-19(25)17-6-3-4-7-18(17)20/h3-9,16,19,25H,2,10-15H2,1H3/t16-,19+/m1/s1 |
| InChIKey | ALQWNBXFBIYKAA-APWZRJJASA-N |
| XLogP | 2.15 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |