C14H14N4O3S — CID 95339405
cis-(1R,2S)-N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 95339405) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is cis-(1R,2S)-N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95339405 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | cis-(1R,2S)-N-[4-[(4-methyl-1,3-thiazol-2-yl)amino]phenyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | Cc1csc(Nc2ccc(NC(=O)[C@@H]3C[C@@H]3[N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H14N4O3S/c1-8-7-22-14(15-8)17-10-4-2-9(3-5-10)16-13(19)11-6-12(11)18(20)21/h2-5,7,11-12H,6H2,1H3,(H,15,17)(H,16,19)/t11-,12+/m1/s1 |
| InChIKey | AXPURAYRSAHXRO-NEPJUHHUSA-N |
| XLogP | 2.80 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|