C12H12ClN3O4 — CID 95340875
cis-(1S,2R)-N-(2-acetamido-5-chlorophenyl)-2-nitrocyclopropane-1-carboxamide (PubChem CID 95340875) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is cis-(1S,2R)-N-(2-acetamido-5-chlorophenyl)-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-(2-acetamido-5-chlorophenyl)-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95340875 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | cis-(1S,2R)-N-(2-acetamido-5-chlorophenyl)-2-nitrocyclopropane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(Cl)cc1NC(=O)[C@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN3O4/c1-6(17)14-9-3-2-7(13)4-10(9)15-12(18)8-5-11(8)16(19)20/h2-4,8,11H,5H2,1H3,(H,14,17)(H,15,18)/t8-,11+/m0/s1 |
| InChIKey | NSBLFSQGQVDZEH-GZMMTYOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|