C15H18N6 — CID 95343247
2-[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 95343247) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 95343247 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CC(C)c1nc2n(n1)C[C@H](Nc1ncccc1C#N)CC2 |
| InChI | InChI=1S/C15H18N6/c1-10(2)14-19-13-6-5-12(9-21(13)20-14)18-15-11(8-16)4-3-7-17-15/h3-4,7,10,12H,5-6,9H2,1-2H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | ITFZCPMXPZHZSD-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |