C18H26N2O4S — CID 95351884
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 95351884) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 95351884 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C18H26N2O4S/c1-12(2)15-6-4-13(3)10-16(15)24-18(21)14-5-7-17-19-25(22,23)9-8-20(17)11-14/h5,7,11-13,15-16H,4,6,8-10H2,1-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | AJPVUCJOHXFWET-VNQPRFMTSA-N |
| XLogP | 2.49 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |