C18H27N5O3 — CID 95354610
1-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea (PubChem CID 95354610) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea.
| Compound Name | 1-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
|---|---|
| PubChem CID | 95354610 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
| SMILES | CC(C)n1ncc2cc(NC(=O)NCCCOC[C@@H]3CCCO3)cnc21 |
| InChI | InChI=1S/C18H27N5O3/c1-13(2)23-17-14(10-21-23)9-15(11-20-17)22-18(24)19-6-4-7-25-12-16-5-3-8-26-16/h9-11,13,16H,3-8,12H2,1-2H3,(H2,19,22,24)/t16-/m0/s1 |
| InChIKey | GXQVLFCAPAOSFB-INIZCTEOSA-N |
| XLogP | 2.72 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|