C14H21NO3 — CID 95358495
ethyl 4-[[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]butanoate (PubChem CID 95358495) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl 4-[[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 95358495 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl 4-[[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H21NO3/c1-2-18-13(16)4-3-7-15-14(17)12-9-10-5-6-11(12)8-10/h5-6,10-12H,2-4,7-9H2,1H3,(H,15,17)/t10-,11+,12+/m1/s1 |
| InChIKey | UXQBMGVWUJYSBI-WOPDTQHZSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|