C15H27NOP2 — CID 167178973
N-(4-dimethylphosphanyl-4-methylphosphanylbutyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 167178973) has the molecular formula C15H27NOP2 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(4-dimethylphosphanyl-4-methylphosphanylbutyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(4-dimethylphosphanyl-4-methylphosphanylbutyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 167178973 |
| Molecular Formula | C15H27NOP2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-(4-dimethylphosphanyl-4-methylphosphanylbutyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CPC(CCCNC(=O)C1CC2C=CC1C2)P(C)C |
| InChI | InChI=1S/C15H27NOP2/c1-18-14(19(2)3)5-4-8-16-15(17)13-10-11-6-7-12(13)9-11/h6-7,11-14,18H,4-5,8-10H2,1-3H3,(H,16,17) |
| InChIKey | PSPYPTHIXKGJDB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|