C12H21NNaO8P2 — CID 175824171
CID 175824171 (PubChem CID 175824171) has the molecular formula C12H21NNaO8P2 and a molecular weight of 392.24 g/mol.
| Compound Name | CID 175824171 |
|---|---|
| PubChem CID | 175824171 |
| Molecular Formula | C12H21NNaO8P2 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | — |
| SMILES | O=C(NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C1CC2C=CC1C2.[Na] |
| InChI | InChI=1S/C12H21NO8P2.Na/c14-11(10-7-8-2-3-9(10)6-8)13-5-1-4-12(15,22(16,17)18)23(19,20)21;/h2-3,8-10,15H,1,4-7H2,(H,13,14)(H2,16,17,18)(H2,19,20,21); |
| InChIKey | GRTIAWOZHBFRQP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|