C14H19NO — CID 103758684
N-hex-5-ynylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 103758684) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-hex-5-ynylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-hex-5-ynylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 103758684 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-hex-5-ynylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C#CCCCCNC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H19NO/c1-2-3-4-5-8-15-14(16)13-10-11-6-7-12(13)9-11/h1,6-7,11-13H,3-5,8-10H2,(H,15,16) |
| InChIKey | XVVBSKYKSHYKMG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|