C27H27N3O5S — CID 95394475
(1S,9S,13R)-4-methoxy-10-(2-methoxyphenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 95394475) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is (1S,9S,13R)-4-methoxy-10-(2-methoxyphenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1S,9S,13R)-4-methoxy-10-(2-methoxyphenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 95394475 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | (1S,9S,13R)-4-methoxy-10-(2-methoxyphenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H]3NC(=S)N(c4ccccc4OC)[C@@]2(C)Oc2ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C27H27N3O5S/c1-27-23(25(31)28-16-9-11-17(32-2)12-10-16)24(19-15-18(33-3)13-14-21(19)35-27)29-26(36)30(27)20-7-5-6-8-22(20)34-4/h5-15,23-24H,1-4H3,(H,28,31)(H,29,36)/t23-,24+,27-/m0/s1 |
| InChIKey | DAXNYHUKPMNOER-XFAFFCHDSA-N |
| XLogP | 4.51 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|