C23H27N3O5S — CID 124746328
(1R,9S,13S)-4-methoxy-10-(2-methoxyethyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 124746328) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is (1R,9S,13S)-4-methoxy-10-(2-methoxyethyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-4-methoxy-10-(2-methoxyethyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 124746328 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (1R,9S,13S)-4-methoxy-10-(2-methoxyethyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COCCN1C(=S)N[C@H]2c3cc(OC)ccc3O[C@@]1(C)[C@H]2C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-23-19(21(27)24-14-5-7-15(29-3)8-6-14)20(25-22(32)26(23)11-12-28-2)17-13-16(30-4)9-10-18(17)31-23/h5-10,13,19-20H,11-12H2,1-4H3,(H,24,27)(H,25,32)/t19-,20+,23+/m1/s1 |
| InChIKey | LBEFVBCAQWKDMX-QTEQDKRBSA-N |
| XLogP | 2.94 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|