C27H26ClN3O3S — CID 92694050
(1R,9R,13R)-N-(4-chlorophenyl)-4-methoxy-9-methyl-10-(2-phenylethyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 92694050) has the molecular formula C27H26ClN3O3S and a molecular weight of 508.04 g/mol. Its IUPAC name is (1R,9R,13R)-N-(4-chlorophenyl)-4-methoxy-9-methyl-10-(2-phenylethyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9R,13R)-N-(4-chlorophenyl)-4-methoxy-9-methyl-10-(2-phenylethyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 92694050 |
| Molecular Formula | C27H26ClN3O3S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | (1R,9R,13R)-N-(4-chlorophenyl)-4-methoxy-9-methyl-10-(2-phenylethyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1ccc2c(c1)[C@@H]1NC(=S)N(CCc3ccccc3)[C@](C)(O2)[C@@H]1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClN3O3S/c1-27-23(25(32)29-19-10-8-18(28)9-11-19)24(21-16-20(33-2)12-13-22(21)34-27)30-26(35)31(27)15-14-17-6-4-3-5-7-17/h3-13,16,23-24H,14-15H2,1-2H3,(H,29,32)(H,30,35)/t23-,24-,27+/m0/s1 |
| InChIKey | QLVRKYDSRWXZLL-NLJOTIRTSA-N |
| XLogP | 5.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|